Hydroxy- and boronic-acid-functionalized carbosilanes: Synthesis and solid state structure of Si(C6H4-4-SiMe2((CH2)3OH))4

Consecutive synthesis methodologies for the preparation of carbosilanes (Ph)(Me)Si((CH2)3B(OH)2)2 (2), Si(C6H4-4-SiMe2((CH2)3B(OH)2))4 (5), (Ph)(Me)Si((CH2)3OH)2 (3), and Si(C6H4-4-SiMe3−n((CH2)3OH)n)4 (6a, n = 1; 6b, n = 2; 6c, n = 3) are reported. Boronic acids 2 and 5 are accessible by treatment of (Ph)(Me)Si(CH2CHdouble bond; length as m-dashCH2)2 (1) or Si(C6H4-4-SiMe2(CH2CHdouble bond; length as m-dashCH2))4 (4a) with HBBr2·SMe2 followed by addition of water, while 3 and 6 are available by the hydroboration of 1 or Si(C6H4-4-SiMe3−n(CH2CHdouble bond; length as m-dashCH2)n)4 (4a, n = 1; 4b, n = 2; 4c, n = 3) with H3B·SMe2 and subsequent oxidation with H2O2. The single molecular structure of 6a in the solid state is reported. Representative is that 6a crystallized in the chiral non-centrosymmetric space group P212121 forming 2D layers due to intermolecular hydrogen bond formation of the HO functionalities along the crystallographic a and c axes.